C16H11NO — CID 158133911
10,11-dihydroindeno[1,2-g]isoquinolin-5-one (PubChem CID 158133911) has the molecular formula C16H11NO and a molecular weight of 233.27 g/mol. Its IUPAC name is 10,11-dihydroindeno[1,2-g]isoquinolin-5-one.
| Compound Name | 10,11-dihydroindeno[1,2-g]isoquinolin-5-one |
|---|---|
| PubChem CID | 158133911 |
| Molecular Formula | C16H11NO |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 10,11-dihydroindeno[1,2-g]isoquinolin-5-one |
| SMILES | O=C1C2=C(Cc3cnccc31)Cc1ccccc12 |
| InChI | InChI=1S/C16H11NO/c18-16-14-5-6-17-9-12(14)8-11-7-10-3-1-2-4-13(10)15(11)16/h1-6,9H,7-8H2 |
| InChIKey | FTCNNZRMUQMGIE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |