C17H10F3NO — CID 158382091
5-(trifluoromethyl)-5,6-dihydroindeno[2,1-g]isoquinolin-11-one (PubChem CID 158382091) has the molecular formula C17H10F3NO and a molecular weight of 301.27 g/mol. Its IUPAC name is 5-(trifluoromethyl)-5,6-dihydroindeno[2,1-g]isoquinolin-11-one.
| Compound Name | 5-(trifluoromethyl)-5,6-dihydroindeno[2,1-g]isoquinolin-11-one |
|---|---|
| PubChem CID | 158382091 |
| Molecular Formula | C17H10F3NO |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-(trifluoromethyl)-5,6-dihydroindeno[2,1-g]isoquinolin-11-one |
| SMILES | O=C1C2=C(Cc3ccccc32)C(C(F)(F)F)c2ccncc21 |
| InChI | InChI=1S/C17H10F3NO/c18-17(19,20)15-11-5-6-21-8-13(11)16(22)14-10-4-2-1-3-9(10)7-12(14)15/h1-6,8,15H,7H2 |
| InChIKey | GVXOEZHFAKEOCG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |