C14H10N2 — CID 144848540
5,8-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11,13,15-heptaene (PubChem CID 144848540) has the molecular formula C14H10N2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 5,8-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11,13,15-heptaene.
| Compound Name | 5,8-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11,13,15-heptaene |
|---|---|
| PubChem CID | 144848540 |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 5,8-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11,13,15-heptaene |
| SMILES | c1ccc2c(c1)Cc1[nH]c3cnccc3c1-2 |
| InChI | InChI=1S/C14H10N2/c1-2-4-10-9(3-1)7-12-14(10)11-5-6-15-8-13(11)16-12/h1-6,8,16H,7H2 |
| InChIKey | NLOVYHCWVBJHQD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |