C23H17N3 — CID 146189960
14-phenyl-6,9,14-triazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,15,17,19-octaene (PubChem CID 146189960) has the molecular formula C23H17N3 and a molecular weight of 335.41 g/mol. Its IUPAC name is 14-phenyl-6,9,14-triazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,15,17,19-octaene.
| Compound Name | 14-phenyl-6,9,14-triazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,15,17,19-octaene |
|---|---|
| PubChem CID | 146189960 |
| Molecular Formula | C23H17N3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 14-phenyl-6,9,14-triazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,15,17,19-octaene |
| SMILES | c1ccc(-n2c3c(c4ccccc42)-c2c([nH]c4cnccc24)CC3)cc1 |
| InChI | InChI=1S/C23H17N3/c1-2-6-15(7-3-1)26-20-9-5-4-8-17(20)23-21(26)11-10-18-22(23)16-12-13-24-14-19(16)25-18/h1-9,12-14,25H,10-11H2 |
| InChIKey | BXAAWBXQMZVAHT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |