About 9-phenylcarbazole;pyridine
9-phenylcarbazole;pyridine (PubChem CID 158880805) has the molecular formula C23H18N2
and a molecular weight of 322.41 g/mol. Its IUPAC name is 9-phenylcarbazole;pyridine.
Molecular Properties
| Compound Name | 9-phenylcarbazole;pyridine |
| PubChem CID | 158880805 |
| Molecular Formula | C23H18N2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 9-phenylcarbazole;pyridine |
| SMILES | c1ccc(-n2c3ccccc3c3ccccc32)cc1.c1ccncc1 |
| InChI | InChI=1S/C18H13N.C5H5N/c1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19;1-2-4-6-5-3-1/h1-13H;1-5H |
| InChIKey | JCZUIBIBERAWTH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-phenylcarbazole;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-phenylcarbazole;pyridine?
The IUPAC name of 9-phenylcarbazole;pyridine (CID 158880805) is 9-phenylcarbazole;pyridine.
What is the SMILES notation for 9-phenylcarbazole;pyridine?
The canonical SMILES for 9-phenylcarbazole;pyridine is c1ccc(-n2c3ccccc3c3ccccc32)cc1.c1ccncc1.
What is the InChIKey of 9-phenylcarbazole;pyridine?
The InChIKey is JCZUIBIBERAWTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N.C5H5N/c1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19;1-2-4-6-5-3-1/h1-13H;1-5H.
What are the key properties of 9-phenylcarbazole;pyridine?
9-phenylcarbazole;pyridine has a molecular weight of 322.41 g/mol, XLogP of 5.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-phenylcarbazole;pyridine is sourced from PubChem (CID 158880805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).