C17H12N2 — CID 15939260
9-phenylpyrido[2,3-b]indole (PubChem CID 15939260) has the molecular formula C17H12N2 and a molecular weight of 244.30 g/mol. Its IUPAC name is 9-phenylpyrido[2,3-b]indole.
| Compound Name | 9-phenylpyrido[2,3-b]indole |
|---|---|
| PubChem CID | 15939260 |
| Molecular Formula | C17H12N2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 9-phenylpyrido[2,3-b]indole |
| SMILES | c1ccc(-n2c3ccccc3c3cccnc32)cc1 |
| InChI | InChI=1S/C17H12N2/c1-2-7-13(8-3-1)19-16-11-5-4-9-14(16)15-10-6-12-18-17(15)19/h1-12H |
| InChIKey | RQXMYDIPSFLXFQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |