C26H17N5 — CID 70836919
9-(4,6-diphenyl-1,3,5-triazin-2-yl)pyrido[2,3-b]indole (PubChem CID 70836919) has the molecular formula C26H17N5 and a molecular weight of 399.46 g/mol. Its IUPAC name is 9-(4,6-diphenyl-1,3,5-triazin-2-yl)pyrido[2,3-b]indole.
| Compound Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 70836919 |
| Molecular Formula | C26H17N5 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)pyrido[2,3-b]indole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4cccnc43)n2)cc1 |
| InChI | InChI=1S/C26H17N5/c1-3-10-18(11-4-1)23-28-24(19-12-5-2-6-13-19)30-26(29-23)31-22-16-8-7-14-20(22)21-15-9-17-27-25(21)31/h1-17H |
| InChIKey | UBJJEXVENNAXGV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |