C35H22N6O — CID 146638502
8-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-phenyl-1,3,8-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12,14,16-heptaen-9-one (PubChem CID 146638502) has the molecular formula C35H22N6O and a molecular weight of 542.60 g/mol. Its IUPAC name is 8-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-phenyl-1,3,8-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12,14,16-heptaen-9-one.
| Compound Name | 8-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-phenyl-1,3,8-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12,14,16-heptaen-9-one |
|---|---|
| PubChem CID | 146638502 |
| Molecular Formula | C35H22N6O |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 8-(4,6-diphenyl-1,3,5-triazin-2-yl)-11-phenyl-1,3,8-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12,14,16-heptaen-9-one |
| SMILES | O=c1c2c(-c3ccccc3)c3ccccc3n2c2ncccc2n1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C35H22N6O/c42-34-30-29(23-13-4-1-5-14-23)26-19-10-11-20-27(26)40(30)33-28(21-12-22-36-33)41(34)35-38-31(24-15-6-2-7-16-24)37-32(39-35)25-17-8-3-9-18-25/h1-22H |
| InChIKey | YPXDALHOPXRNTO-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 77.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |