C45H28N8O — CID 155120301
5,12-bis(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[1,2-c]quinazolin-6-one (PubChem CID 155120301) has the molecular formula C45H28N8O and a molecular weight of 696.77 g/mol. Its IUPAC name is 5,12-bis(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[1,2-c]quinazolin-6-one.
| Compound Name | 5,12-bis(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[1,2-c]quinazolin-6-one |
|---|---|
| PubChem CID | 155120301 |
| Molecular Formula | C45H28N8O |
| Molecular Weight | 696.77 g/mol |
| Exact Mass | 696.24 |
| IUPAC Name | 5,12-bis(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[1,2-c]quinazolin-6-one |
| SMILES | O=c1n(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c2ccccc2c2c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c3ccccc3n12 |
| InChI | InChI=1S/C45H28N8O/c54-45-52-35-27-15-13-25-33(35)37(43-48-39(29-17-5-1-6-18-29)46-40(49-43)30-19-7-2-8-20-30)38(52)34-26-14-16-28-36(34)53(45)44-50-41(31-21-9-3-10-22-31)47-42(51-44)32-23-11-4-12-24-32/h1-28H |
| InChIKey | FXWJLSWYCCOKSB-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 103.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.77 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |