About ethane;9-methylcarbazole;9-phenylcarbazole
ethane;9-methylcarbazole;9-phenylcarbazole (PubChem CID 159293304) has the molecular formula C43H60N2
and a molecular weight of 604.97 g/mol. Its IUPAC name is ethane;9-methylcarbazole;9-phenylcarbazole.
Molecular Properties
| Compound Name | ethane;9-methylcarbazole;9-phenylcarbazole |
| PubChem CID | 159293304 |
| Molecular Formula | C43H60N2 |
| Molecular Weight | 604.97 g/mol |
| Exact Mass | 604.48 |
| IUPAC Name | ethane;9-methylcarbazole;9-phenylcarbazole |
| SMILES | CC.CC.CC.CC.CC.CC.Cn1c2ccccc2c2ccccc21.c1ccc(-n2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C18H13N.C13H11N.6C2H6/c1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19;1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14;6*1-2/h1-13H;2-9H,1H3;6*1-2H3 |
| InChIKey | LAKAIZBYTDELKL-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 604.97 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;9-methylcarbazole;9-phenylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;9-methylcarbazole;9-phenylcarbazole?
The IUPAC name of ethane;9-methylcarbazole;9-phenylcarbazole (CID 159293304) is ethane;9-methylcarbazole;9-phenylcarbazole.
What is the SMILES notation for ethane;9-methylcarbazole;9-phenylcarbazole?
The canonical SMILES for ethane;9-methylcarbazole;9-phenylcarbazole is CC.CC.CC.CC.CC.CC.Cn1c2ccccc2c2ccccc21.c1ccc(-n2c3ccccc3c3ccccc32)cc1.
What is the InChIKey of ethane;9-methylcarbazole;9-phenylcarbazole?
The InChIKey is LAKAIZBYTDELKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N.C13H11N.6C2H6/c1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19;1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14;6*1-2/h1-13H;2-9H,1H3;6*1-2H3.
What are the key properties of ethane;9-methylcarbazole;9-phenylcarbazole?
ethane;9-methylcarbazole;9-phenylcarbazole has a molecular weight of 604.97 g/mol, XLogP of 14.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9-methylcarbazole;9-phenylcarbazole is sourced from PubChem (CID 159293304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).