C33H34N2 — CID 142288602
(2E,3Z)-2,3-di(ethylidene)-1-phenylindole;ethane;9-methylcarbazole (PubChem CID 142288602) has the molecular formula C33H34N2 and a molecular weight of 458.65 g/mol. Its IUPAC name is (2E,3Z)-2,3-di(ethylidene)-1-phenylindole;ethane;9-methylcarbazole.
| Compound Name | (2E,3Z)-2,3-di(ethylidene)-1-phenylindole;ethane;9-methylcarbazole |
|---|---|
| PubChem CID | 142288602 |
| Molecular Formula | C33H34N2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | (2E,3Z)-2,3-di(ethylidene)-1-phenylindole;ethane;9-methylcarbazole |
| SMILES | C/C=c1\c(=C/C)n(-c2ccccc2)c2ccccc12.CC.Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C18H17N.C13H11N.C2H6/c1-3-15-16-12-8-9-13-18(16)19(17(15)4-2)14-10-6-5-7-11-14;1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14;1-2/h3-13H,1-2H3;2-9H,1H3;1-2H3/b15-3-,17-4+;; |
| InChIKey | LHFLVGFIICUJBP-RWYOTXNWSA-N |
| XLogP | 7.59 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |