C50H42N2 — CID 142521163
3-[(2E,3Z)-2,3-di(ethylidene)-1-(3-phenylphenyl)indol-5-yl]-9-(3-phenylphenyl)carbazole;ethane (PubChem CID 142521163) has the molecular formula C50H42N2 and a molecular weight of 670.90 g/mol. Its IUPAC name is 3-[(2E,3Z)-2,3-di(ethylidene)-1-(3-phenylphenyl)indol-5-yl]-9-(3-phenylphenyl)carbazole;ethane.
| Compound Name | 3-[(2E,3Z)-2,3-di(ethylidene)-1-(3-phenylphenyl)indol-5-yl]-9-(3-phenylphenyl)carbazole;ethane |
|---|---|
| PubChem CID | 142521163 |
| Molecular Formula | C50H42N2 |
| Molecular Weight | 670.90 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | 3-[(2E,3Z)-2,3-di(ethylidene)-1-(3-phenylphenyl)indol-5-yl]-9-(3-phenylphenyl)carbazole;ethane |
| SMILES | C/C=c1\c(=C/C)n(-c2cccc(-c3ccccc3)c2)c2ccc(-c3ccc4c(c3)c3ccccc3n4-c3cccc(-c4ccccc4)c3)cc12.CC |
| InChI | InChI=1S/C48H36N2.C2H6/c1-3-41-43-31-37(25-27-47(43)49(45(41)4-2)39-21-13-19-35(29-39)33-15-7-5-8-16-33)38-26-28-48-44(32-38)42-23-11-12-24-46(42)50(48)40-22-14-20-36(30-40)34-17-9-6-10-18-34;1-2/h3-32H,1-2H3;1-2H3/b41-3-,45-4+; |
| InChIKey | KSXIQHZTTIUGTG-IEGYGRBESA-N |
| XLogP | 12.36 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.90 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |