C48H36N2O10 — CID 153344471
6-[3-[3-[(2E,3Z)-2,3-di(ethylidene)-1-phenylindol-5-yl]carbazol-9-yl]-5-(2,3,4,5,6-pentahydroxyphenyl)phenyl]benzene-1,2,3,4,5-pentol (PubChem CID 153344471) has the molecular formula C48H36N2O10 and a molecular weight of 800.82 g/mol. Its IUPAC name is 6-[3-[3-[(2E,3Z)-2,3-di(ethylidene)-1-phenylindol-5-yl]carbazol-9-yl]-5-(2,3,4,5,6-pentahydroxyphenyl)phenyl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[3-[3-[(2E,3Z)-2,3-di(ethylidene)-1-phenylindol-5-yl]carbazol-9-yl]-5-(2,3,4,5,6-pentahydroxyphenyl)phenyl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 153344471 |
| Molecular Formula | C48H36N2O10 |
| Molecular Weight | 800.82 g/mol |
| Exact Mass | 800.24 |
| IUPAC Name | 6-[3-[3-[(2E,3Z)-2,3-di(ethylidene)-1-phenylindol-5-yl]carbazol-9-yl]-5-(2,3,4,5,6-pentahydroxyphenyl)phenyl]benzene-1,2,3,4,5-pentol |
| SMILES | C/C=c1\c(=C/C)n(-c2ccccc2)c2ccc(-c3ccc4c(c3)c3ccccc3n4-c3cc(-c4c(O)c(O)c(O)c(O)c4O)cc(-c4c(O)c(O)c(O)c(O)c4O)c3)cc12 |
| InChI | InChI=1S/C48H36N2O10/c1-3-29-31-21-23(14-16-35(31)49(33(29)4-2)27-10-6-5-7-11-27)24-15-17-36-32(22-24)30-12-8-9-13-34(30)50(36)28-19-25(37-39(51)43(55)47(59)44(56)40(37)52)18-26(20-28)38-41(53)45(57)48(60)46(58)42(38)54/h3-22,51-60H,1-2H3/b29-3-,33-4+ |
| InChIKey | MNUFBABKMBTVJE-LQXJNDTQSA-N |
| XLogP | 8.39 |
| TPSA | 212.16 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.82 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|