C48H36N2 — CID 142521068
3-[(2E,3Z)-2,3-di(ethylidene)-1-phenylindol-5-yl]-9-phenyl-6-(4-phenylphenyl)carbazole (PubChem CID 142521068) has the molecular formula C48H36N2 and a molecular weight of 640.83 g/mol. Its IUPAC name is 3-[(2E,3Z)-2,3-di(ethylidene)-1-phenylindol-5-yl]-9-phenyl-6-(4-phenylphenyl)carbazole.
| Compound Name | 3-[(2E,3Z)-2,3-di(ethylidene)-1-phenylindol-5-yl]-9-phenyl-6-(4-phenylphenyl)carbazole |
|---|---|
| PubChem CID | 142521068 |
| Molecular Formula | C48H36N2 |
| Molecular Weight | 640.83 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | 3-[(2E,3Z)-2,3-di(ethylidene)-1-phenylindol-5-yl]-9-phenyl-6-(4-phenylphenyl)carbazole |
| SMILES | C/C=c1\c(=C/C)n(-c2ccccc2)c2ccc(-c3ccc4c(c3)c3cc(-c5ccc(-c6ccccc6)cc5)ccc3n4-c3ccccc3)cc12 |
| InChI | InChI=1S/C48H36N2/c1-3-41-42-31-37(25-28-46(42)49(45(41)4-2)39-16-10-6-11-17-39)38-26-29-48-44(32-38)43-30-36(24-27-47(43)50(48)40-18-12-7-13-19-40)35-22-20-34(21-23-35)33-14-8-5-9-15-33/h3-32H,1-2H3/b41-3-,45-4+ |
| InChIKey | QDHRATDWCVLVMK-TVLFFOOTSA-N |
| XLogP | 11.33 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.83 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |