C28H23N3O2 — CID 172941326
6-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one;(NE)-N-(6-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)hydroxylamine (PubChem CID 172941326) has the molecular formula C28H23N3O2 and a molecular weight of 433.51 g/mol. Its IUPAC name is 6-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one;(NE)-N-(6-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)hydroxylamine.
| Compound Name | 6-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one;(NE)-N-(6-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 172941326 |
| Molecular Formula | C28H23N3O2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 6-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one;(NE)-N-(6-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)hydroxylamine |
| SMILES | O/N=C1\c2ccccc2CCc2cnccc21.O=C1c2ccccc2CCc2cnccc21 |
| InChI | InChI=1S/C14H12N2O.C14H11NO/c17-16-14-12-4-2-1-3-10(12)5-6-11-9-15-8-7-13(11)14;16-14-12-4-2-1-3-10(12)5-6-11-9-15-8-7-13(11)14/h1-4,7-9,17H,5-6H2;1-4,7-9H,5-6H2/b16-14+; |
| InChIKey | ZKNJSPAFLLNMLN-BACBYAOASA-N |
| XLogP | 4.82 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|