C9H10N2O — CID 135742182
N-(7,8-dihydro-6H-isoquinolin-5-ylidene)hydroxylamine (PubChem CID 135742182) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is N-(7,8-dihydro-6H-isoquinolin-5-ylidene)hydroxylamine.
| Compound Name | N-(7,8-dihydro-6H-isoquinolin-5-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 135742182 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | N-(7,8-dihydro-6H-isoquinolin-5-ylidene)hydroxylamine |
| SMILES | ON=C1CCCc2cnccc21 |
| InChI | InChI=1S/C9H10N2O/c12-11-9-3-1-2-7-6-10-5-4-8(7)9/h4-6,12H,1-3H2 |
| InChIKey | ODZAZPZPVLNASI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|