C10H10FNO — CID 145095374
(NE)-N-(6-fluoro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine (PubChem CID 145095374) has the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. Its IUPAC name is (NE)-N-(6-fluoro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(6-fluoro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 145095374 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | (NE)-N-(6-fluoro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine |
| SMILES | O/N=C1\CCCc2cc(F)ccc21 |
| InChI | InChI=1S/C10H10FNO/c11-8-4-5-9-7(6-8)2-1-3-10(9)12-13/h4-6,13H,1-3H2/b12-10+ |
| InChIKey | SENHZFZRHBVFKU-ZRDIBKRKSA-N |
| XLogP | 2.34 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|