C16H22N+ — CID 151821101
trimethyl(2,3,4,9-tetrahydro-1H-fluoren-1-yl)azanium (PubChem CID 151821101) has the molecular formula C16H22N+ and a molecular weight of 228.36 g/mol. Its IUPAC name is trimethyl(2,3,4,9-tetrahydro-1H-fluoren-1-yl)azanium.
| Compound Name | trimethyl(2,3,4,9-tetrahydro-1H-fluoren-1-yl)azanium |
|---|---|
| PubChem CID | 151821101 |
| Molecular Formula | C16H22N+ |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | trimethyl(2,3,4,9-tetrahydro-1H-fluoren-1-yl)azanium |
| SMILES | C[N+](C)(C)C1CCCC2=C1Cc1ccccc12 |
| InChI | InChI=1S/C16H22N/c1-17(2,3)16-10-6-9-14-13-8-5-4-7-12(13)11-15(14)16/h4-5,7-8,16H,6,9-11H2,1-3H3/q+1 |
| InChIKey | SCQMDLCAVAHQCN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|