C25H32N4 — CID 142474512
(11Z)-12-[amino(methyl)amino]-5-(6-methyl-5-methylidenehept-1-en-2-yl)-6H-benzo[c][1]benzazocin-11-amine (PubChem CID 142474512) has the molecular formula C25H32N4 and a molecular weight of 388.56 g/mol. Its IUPAC name is (11Z)-12-[amino(methyl)amino]-5-(6-methyl-5-methylidenehept-1-en-2-yl)-6H-benzo[c][1]benzazocin-11-amine.
| Compound Name | (11Z)-12-[amino(methyl)amino]-5-(6-methyl-5-methylidenehept-1-en-2-yl)-6H-benzo[c][1]benzazocin-11-amine |
|---|---|
| PubChem CID | 142474512 |
| Molecular Formula | C25H32N4 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (11Z)-12-[amino(methyl)amino]-5-(6-methyl-5-methylidenehept-1-en-2-yl)-6H-benzo[c][1]benzazocin-11-amine |
| SMILES | C=C(CCC(=C)N1Cc2ccccc2/C(N)=C(/N(C)N)c2ccccc21)C(C)C |
| InChI | InChI=1S/C25H32N4/c1-17(2)18(3)14-15-19(4)29-16-20-10-6-7-11-21(20)24(26)25(28(5)27)22-12-8-9-13-23(22)29/h6-13,17H,3-4,14-16,26-27H2,1-2,5H3/b25-24- |
| InChIKey | GQFNWAMFUBOTOF-IZHYLOQSSA-N |
| XLogP | 5.10 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|