C34H52N5O3P — CID 176696067
1-[(11Z)-11-amino-12-[amino-[2-methyl-4-[methyl(methylamino)phosphoryl]butan-2-yl]amino]-6H-benzo[c][1]benzazocin-5-yl]-2,2,5,5-tetramethyloctane-1,6-dione (PubChem CID 176696067) has the molecular formula C34H52N5O3P and a molecular weight of 609.80 g/mol. Its IUPAC name is 1-[(11Z)-11-amino-12-[amino-[2-methyl-4-[methyl(methylamino)phosphoryl]butan-2-yl]amino]-6H-benzo[c][1]benzazocin-5-yl]-2,2,5,5-tetramethyloctane-1,6-dione.
| Compound Name | 1-[(11Z)-11-amino-12-[amino-[2-methyl-4-[methyl(methylamino)phosphoryl]butan-2-yl]amino]-6H-benzo[c][1]benzazocin-5-yl]-2,2,5,5-tetramethyloctane-1,6-dione |
|---|---|
| PubChem CID | 176696067 |
| Molecular Formula | C34H52N5O3P |
| Molecular Weight | 609.80 g/mol |
| Exact Mass | 609.38 |
| IUPAC Name | 1-[(11Z)-11-amino-12-[amino-[2-methyl-4-[methyl(methylamino)phosphoryl]butan-2-yl]amino]-6H-benzo[c][1]benzazocin-5-yl]-2,2,5,5-tetramethyloctane-1,6-dione |
| SMILES | CCC(=O)C(C)(C)CCC(C)(C)C(=O)N1Cc2ccccc2/C(N)=C(/N(N)C(C)(C)CCP(C)(=O)NC)c2ccccc21 |
| InChI | InChI=1S/C34H52N5O3P/c1-10-28(40)32(2,3)19-20-33(4,5)31(41)38-23-24-15-11-12-16-25(24)29(35)30(26-17-13-14-18-27(26)38)39(36)34(6,7)21-22-43(9,42)37-8/h11-18H,10,19-23,35-36H2,1-9H3,(H,37,42)/b30-29- |
| InChIKey | GHOQZLUNYVZSDQ-FLWNBWAVSA-N |
| XLogP | 6.60 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.80 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|