C21H26N6O2 — CID 176980919
1-[2-[(11Z)-11-amino-12-[amino(ethyl)amino]-6H-benzo[c][1]benzazocin-5-yl]-2-oxoethyl]-1-methylurea (PubChem CID 176980919) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 1-[2-[(11Z)-11-amino-12-[amino(ethyl)amino]-6H-benzo[c][1]benzazocin-5-yl]-2-oxoethyl]-1-methylurea.
| Compound Name | 1-[2-[(11Z)-11-amino-12-[amino(ethyl)amino]-6H-benzo[c][1]benzazocin-5-yl]-2-oxoethyl]-1-methylurea |
|---|---|
| PubChem CID | 176980919 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 1-[2-[(11Z)-11-amino-12-[amino(ethyl)amino]-6H-benzo[c][1]benzazocin-5-yl]-2-oxoethyl]-1-methylurea |
| SMILES | CCN(N)/C1=C(\N)c2ccccc2CN(C(=O)CN(C)C(N)=O)c2ccccc21 |
| InChI | InChI=1S/C21H26N6O2/c1-3-27(24)20-16-10-6-7-11-17(16)26(18(28)13-25(2)21(23)29)12-14-8-4-5-9-15(14)19(20)22/h4-11H,3,12-13,22,24H2,1-2H3,(H2,23,29)/b20-19- |
| InChIKey | UBSMTPBJQVLMMS-VXPUYCOJSA-N |
| XLogP | 1.52 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|