C33H50N6O5 — CID 156649535
2-[amino-[(11Z)-11-amino-5-[3-(methylamino)propanoyl]-6H-benzo[c][1]benzazocin-12-yl]amino]ethyl N-pentylcarbamate;3-propoxypropanal (PubChem CID 156649535) has the molecular formula C33H50N6O5 and a molecular weight of 610.80 g/mol. Its IUPAC name is 2-[amino-[(11Z)-11-amino-5-[3-(methylamino)propanoyl]-6H-benzo[c][1]benzazocin-12-yl]amino]ethyl N-pentylcarbamate;3-propoxypropanal.
| Compound Name | 2-[amino-[(11Z)-11-amino-5-[3-(methylamino)propanoyl]-6H-benzo[c][1]benzazocin-12-yl]amino]ethyl N-pentylcarbamate;3-propoxypropanal |
|---|---|
| PubChem CID | 156649535 |
| Molecular Formula | C33H50N6O5 |
| Molecular Weight | 610.80 g/mol |
| Exact Mass | 610.38 |
| IUPAC Name | 2-[amino-[(11Z)-11-amino-5-[3-(methylamino)propanoyl]-6H-benzo[c][1]benzazocin-12-yl]amino]ethyl N-pentylcarbamate;3-propoxypropanal |
| SMILES | CCCCCNC(=O)OCCN(N)/C1=C(\N)c2ccccc2CN(C(=O)CCNC)c2ccccc21.CCCOCCC=O |
| InChI | InChI=1S/C27H38N6O3.C6H12O2/c1-3-4-9-15-31-27(35)36-18-17-33(29)26-22-12-7-8-13-23(22)32(24(34)14-16-30-2)19-20-10-5-6-11-21(20)25(26)28;1-2-5-8-6-3-4-7/h5-8,10-13,30H,3-4,9,14-19,28-29H2,1-2H3,(H,31,35);4H,2-3,5-6H2,1H3/b26-25-; |
| InChIKey | RSXPIXXELKMZFT-OQKDUQJOSA-N |
| XLogP | 4.02 |
| TPSA | 152.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.80 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|