C32H50N6O4S — CID 166157832
2-[[(11Z)-5-acetyl-12-amino-6H-benzo[c][1]benzazocin-11-yl]-aminoamino]ethyl N-[5-(methylsulfanylamino)-6-oxoheptyl]carbamate;ethane (PubChem CID 166157832) has the molecular formula C32H50N6O4S and a molecular weight of 614.86 g/mol. Its IUPAC name is 2-[[(11Z)-5-acetyl-12-amino-6H-benzo[c][1]benzazocin-11-yl]-aminoamino]ethyl N-[5-(methylsulfanylamino)-6-oxoheptyl]carbamate;ethane.
| Compound Name | 2-[[(11Z)-5-acetyl-12-amino-6H-benzo[c][1]benzazocin-11-yl]-aminoamino]ethyl N-[5-(methylsulfanylamino)-6-oxoheptyl]carbamate;ethane |
|---|---|
| PubChem CID | 166157832 |
| Molecular Formula | C32H50N6O4S |
| Molecular Weight | 614.86 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | 2-[[(11Z)-5-acetyl-12-amino-6H-benzo[c][1]benzazocin-11-yl]-aminoamino]ethyl N-[5-(methylsulfanylamino)-6-oxoheptyl]carbamate;ethane |
| SMILES | CC.CC.CSNC(CCCCNC(=O)OCCN(N)/C1=C(\N)c2ccccc2N(C(C)=O)Cc2ccccc21)C(C)=O |
| InChI | InChI=1S/C28H38N6O4S.2C2H6/c1-19(35)24(32-39-3)13-8-9-15-31-28(37)38-17-16-34(30)27-22-11-5-4-10-21(22)18-33(20(2)36)25-14-7-6-12-23(25)26(27)29;2*1-2/h4-7,10-12,14,24,32H,8-9,13,15-18,29-30H2,1-3H3,(H,31,37);2*1-2H3/b27-26-;; |
| InChIKey | KOOOVQGPLBQGIB-ZNKLZGLFSA-N |
| XLogP | 5.29 |
| TPSA | 143.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.86 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|