C29H39N5O4 — CID 167499568
2-amino-6-[amino-[(11Z)-11-amino-5-(6-oxooctanoyl)-6H-benzo[c][1]benzazocin-12-yl]amino]hexanoic acid (PubChem CID 167499568) has the molecular formula C29H39N5O4 and a molecular weight of 521.66 g/mol. Its IUPAC name is 2-amino-6-[amino-[(11Z)-11-amino-5-(6-oxooctanoyl)-6H-benzo[c][1]benzazocin-12-yl]amino]hexanoic acid.
| Compound Name | 2-amino-6-[amino-[(11Z)-11-amino-5-(6-oxooctanoyl)-6H-benzo[c][1]benzazocin-12-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 167499568 |
| Molecular Formula | C29H39N5O4 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | 2-amino-6-[amino-[(11Z)-11-amino-5-(6-oxooctanoyl)-6H-benzo[c][1]benzazocin-12-yl]amino]hexanoic acid |
| SMILES | CCC(=O)CCCCC(=O)N1Cc2ccccc2/C(N)=C(/N(N)CCCCC(N)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C29H39N5O4/c1-2-21(35)12-4-8-17-26(36)33-19-20-11-3-5-13-22(20)27(31)28(23-14-6-7-16-25(23)33)34(32)18-10-9-15-24(30)29(37)38/h3,5-7,11,13-14,16,24H,2,4,8-10,12,15,17-19,30-32H2,1H3,(H,37,38)/b28-27- |
| InChIKey | NFCCFBYCHGPNTF-DQSJHHFOSA-N |
| XLogP | 3.62 |
| TPSA | 155.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|