C24H30N4 — CID 142474579
(11Z)-12-[amino(methyl)amino]-5-(5-methylidenehept-1-en-2-yl)-6H-benzo[c][1]benzazocin-11-amine (PubChem CID 142474579) has the molecular formula C24H30N4 and a molecular weight of 374.53 g/mol. Its IUPAC name is (11Z)-12-[amino(methyl)amino]-5-(5-methylidenehept-1-en-2-yl)-6H-benzo[c][1]benzazocin-11-amine.
| Compound Name | (11Z)-12-[amino(methyl)amino]-5-(5-methylidenehept-1-en-2-yl)-6H-benzo[c][1]benzazocin-11-amine |
|---|---|
| PubChem CID | 142474579 |
| Molecular Formula | C24H30N4 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (11Z)-12-[amino(methyl)amino]-5-(5-methylidenehept-1-en-2-yl)-6H-benzo[c][1]benzazocin-11-amine |
| SMILES | C=C(CC)CCC(=C)N1Cc2ccccc2/C(N)=C(/N(C)N)c2ccccc21 |
| InChI | InChI=1S/C24H30N4/c1-5-17(2)14-15-18(3)28-16-19-10-6-7-11-20(19)23(25)24(27(4)26)21-12-8-9-13-22(21)28/h6-13H,2-3,5,14-16,25-26H2,1,4H3/b24-23- |
| InChIKey | IXUVPWVXTWGYDD-VHXPQNKSSA-N |
| XLogP | 4.86 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|