C22H30N4O — CID 146253619
1-[12-amino-11-[amino(propan-2-yl)amino]-11,12-dihydro-6H-benzo[c][1]benzazocin-5-yl]-2-methylpropan-1-one (PubChem CID 146253619) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-[12-amino-11-[amino(propan-2-yl)amino]-11,12-dihydro-6H-benzo[c][1]benzazocin-5-yl]-2-methylpropan-1-one.
| Compound Name | 1-[12-amino-11-[amino(propan-2-yl)amino]-11,12-dihydro-6H-benzo[c][1]benzazocin-5-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 146253619 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 1-[12-amino-11-[amino(propan-2-yl)amino]-11,12-dihydro-6H-benzo[c][1]benzazocin-5-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1Cc2ccccc2C(N(N)C(C)C)C(N)c2ccccc21 |
| InChI | InChI=1S/C22H30N4O/c1-14(2)22(27)25-13-16-9-5-6-10-17(16)21(26(24)15(3)4)20(23)18-11-7-8-12-19(18)25/h5-12,14-15,20-21H,13,23-24H2,1-4H3 |
| InChIKey | XGXPBEVRBKBEPH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|