C16H15NO2S2 — CID 139792151
4-(1,3-dithiol-2-ylidene)-1-propan-2-yl-2H-1-benzazepine-3,5-dione (PubChem CID 139792151) has the molecular formula C16H15NO2S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 4-(1,3-dithiol-2-ylidene)-1-propan-2-yl-2H-1-benzazepine-3,5-dione.
| Compound Name | 4-(1,3-dithiol-2-ylidene)-1-propan-2-yl-2H-1-benzazepine-3,5-dione |
|---|---|
| PubChem CID | 139792151 |
| Molecular Formula | C16H15NO2S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 4-(1,3-dithiol-2-ylidene)-1-propan-2-yl-2H-1-benzazepine-3,5-dione |
| SMILES | CC(C)N1CC(=O)C(=C2SC=CS2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H15NO2S2/c1-10(2)17-9-13(18)14(16-20-7-8-21-16)15(19)11-5-3-4-6-12(11)17/h3-8,10H,9H2,1-2H3 |
| InChIKey | VTZBLURPFGEEHW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|