C13H16FNOS — CID 61419831
1-[2-fluoro-6-(1,4-thiazepan-4-yl)phenyl]ethanone (PubChem CID 61419831) has the molecular formula C13H16FNOS and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-[2-fluoro-6-(1,4-thiazepan-4-yl)phenyl]ethanone.
| Compound Name | 1-[2-fluoro-6-(1,4-thiazepan-4-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 61419831 |
| Molecular Formula | C13H16FNOS |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-[2-fluoro-6-(1,4-thiazepan-4-yl)phenyl]ethanone |
| SMILES | CC(=O)c1c(F)cccc1N1CCCSCC1 |
| InChI | InChI=1S/C13H16FNOS/c1-10(16)13-11(14)4-2-5-12(13)15-6-3-8-17-9-7-15/h2,4-5H,3,6-9H2,1H3 |
| InChIKey | LDNJPZZXHGADFF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |