C14H21Cl2FN2O2 — CID 167936540
1-[2-[4-(aminomethyl)-4-hydroxypiperidin-1-yl]-6-fluorophenyl]ethanone;dihydrochloride (PubChem CID 167936540) has the molecular formula C14H21Cl2FN2O2 and a molecular weight of 339.24 g/mol. Its IUPAC name is 1-[2-[4-(aminomethyl)-4-hydroxypiperidin-1-yl]-6-fluorophenyl]ethanone;dihydrochloride.
| Compound Name | 1-[2-[4-(aminomethyl)-4-hydroxypiperidin-1-yl]-6-fluorophenyl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 167936540 |
| Molecular Formula | C14H21Cl2FN2O2 |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-[2-[4-(aminomethyl)-4-hydroxypiperidin-1-yl]-6-fluorophenyl]ethanone;dihydrochloride |
| SMILES | CC(=O)c1c(F)cccc1N1CCC(O)(CN)CC1.Cl.Cl |
| InChI | InChI=1S/C14H19FN2O2.2ClH/c1-10(18)13-11(15)3-2-4-12(13)17-7-5-14(19,9-16)6-8-17;;/h2-4,19H,5-9,16H2,1H3;2*1H |
| InChIKey | ARVUKCSBJDARCE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |