C10H11N — CID 137483328
4-methyl-3-methylidene-1,2-dihydroisoindole (PubChem CID 137483328) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 4-methyl-3-methylidene-1,2-dihydroisoindole.
| Compound Name | 4-methyl-3-methylidene-1,2-dihydroisoindole |
|---|---|
| PubChem CID | 137483328 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 4-methyl-3-methylidene-1,2-dihydroisoindole |
| SMILES | C=C1NCc2cccc(C)c21 |
| InChI | InChI=1S/C10H11N/c1-7-4-3-5-9-6-11-8(2)10(7)9/h3-5,11H,2,6H2,1H3 |
| InChIKey | JDBXPYRCMSIGCK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |