C40H42 — CID 176589323
1,2,4,5-tetrakis(2,6-dimethylphenyl)-3,6-dimethylbenzene (PubChem CID 176589323) has the molecular formula C40H42 and a molecular weight of 522.78 g/mol. Its IUPAC name is 1,2,4,5-tetrakis(2,6-dimethylphenyl)-3,6-dimethylbenzene.
| Compound Name | 1,2,4,5-tetrakis(2,6-dimethylphenyl)-3,6-dimethylbenzene |
|---|---|
| PubChem CID | 176589323 |
| Molecular Formula | C40H42 |
| Molecular Weight | 522.78 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | 1,2,4,5-tetrakis(2,6-dimethylphenyl)-3,6-dimethylbenzene |
| SMILES | Cc1cccc(C)c1-c1c(C)c(-c2c(C)cccc2C)c(-c2c(C)cccc2C)c(C)c1-c1c(C)cccc1C |
| InChI | InChI=1S/C40H42/c1-23-15-11-16-24(2)33(23)37-31(9)39(35-27(5)19-13-20-28(35)6)40(36-29(7)21-14-22-30(36)8)32(10)38(37)34-25(3)17-12-18-26(34)4/h11-22H,1-10H3 |
| InChIKey | NRVPNOZGSCDLHE-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.78 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |