C44H50 — CID 57209426
2-(2,6-dimethylphenyl)-1,3,5-trimethyl-4-[2,4,6-trimethyl-3-[2,4,6-trimethyl-3-(2,4,6-trimethylphenyl)phenyl]phenyl]benzene (PubChem CID 57209426) has the molecular formula C44H50 and a molecular weight of 578.88 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-1,3,5-trimethyl-4-[2,4,6-trimethyl-3-[2,4,6-trimethyl-3-(2,4,6-trimethylphenyl)phenyl]phenyl]benzene.
| Compound Name | 2-(2,6-dimethylphenyl)-1,3,5-trimethyl-4-[2,4,6-trimethyl-3-[2,4,6-trimethyl-3-(2,4,6-trimethylphenyl)phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 57209426 |
| Molecular Formula | C44H50 |
| Molecular Weight | 578.88 g/mol |
| Exact Mass | 578.39 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-1,3,5-trimethyl-4-[2,4,6-trimethyl-3-[2,4,6-trimethyl-3-(2,4,6-trimethylphenyl)phenyl]phenyl]benzene |
| SMILES | Cc1cc(C)c(-c2c(C)cc(C)c(-c3c(C)cc(C)c(-c4c(C)cc(C)c(-c5c(C)cccc5C)c4C)c3C)c2C)c(C)c1 |
| InChI | InChI=1S/C44H50/c1-23-18-26(4)38(27(5)19-23)40-29(7)21-31(9)42(35(40)13)44-33(11)22-32(10)43(36(44)14)41-30(8)20-28(6)39(34(41)12)37-24(2)16-15-17-25(37)3/h15-22H,1-14H3 |
| InChIKey | BLXPTVNJSGNAOJ-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.88 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |