C12H12S — CID 58838883
2-(2,6-dimethylphenyl)thiophene (PubChem CID 58838883) has the molecular formula C12H12S and a molecular weight of 188.29 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)thiophene.
| Compound Name | 2-(2,6-dimethylphenyl)thiophene |
|---|---|
| PubChem CID | 58838883 |
| Molecular Formula | C12H12S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 2-(2,6-dimethylphenyl)thiophene |
| SMILES | Cc1cccc(C)c1-c1cccs1 |
| InChI | InChI=1S/C12H12S/c1-9-5-3-6-10(2)12(9)11-7-4-8-13-11/h3-8H,1-2H3 |
| InChIKey | SPCZERWQJSWTHS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |