C21H20O2S — CID 141257955
4-(3,5-dimethyl-4-thiophen-2-ylphenyl)-2,6-dimethylbenzoic acid (PubChem CID 141257955) has the molecular formula C21H20O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 4-(3,5-dimethyl-4-thiophen-2-ylphenyl)-2,6-dimethylbenzoic acid.
| Compound Name | 4-(3,5-dimethyl-4-thiophen-2-ylphenyl)-2,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 141257955 |
| Molecular Formula | C21H20O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-(3,5-dimethyl-4-thiophen-2-ylphenyl)-2,6-dimethylbenzoic acid |
| SMILES | Cc1cc(-c2cc(C)c(-c3cccs3)c(C)c2)cc(C)c1C(=O)O |
| InChI | InChI=1S/C21H20O2S/c1-12-8-16(9-13(2)19(12)18-6-5-7-24-18)17-10-14(3)20(21(22)23)15(4)11-17/h5-11H,1-4H3,(H,22,23) |
| InChIKey | XNGSBPBQPDBBGP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |