About 4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid
4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid (PubChem CID 123432143) has the molecular formula C17H19NO5
and a molecular weight of 317.34 g/mol. Its IUPAC name is 4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid |
| PubChem CID | 123432143 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NC(CC1=CCCc2ccccc21)C(=O)O |
| InChI | InChI=1S/C17H19NO5/c19-15(8-9-16(20)21)18-14(17(22)23)10-12-6-3-5-11-4-1-2-7-13(11)12/h1-2,4,6-7,14H,3,5,8-10H2,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | DYKFRBUAJBAFDZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid?
The IUPAC name of 4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid (CID 123432143) is 4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid.
What is the SMILES notation for 4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid?
The canonical SMILES for 4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid is O=C(O)CCC(=O)NC(CC1=CCCc2ccccc21)C(=O)O.
What is the InChIKey of 4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid?
The InChIKey is DYKFRBUAJBAFDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO5/c19-15(8-9-16(20)21)18-14(17(22)23)10-12-6-3-5-11-4-1-2-7-13(11)12/h1-2,4,6-7,14H,3,5,8-10H2,(H,18,19)(H,20,21)(H,22,23).
What are the key properties of 4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid?
4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid has a molecular weight of 317.34 g/mol, XLogP of 1.84, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-carboxy-2-(3,4-dihydronaphthalen-1-yl)ethyl]amino]-4-oxobutanoic acid is sourced from PubChem (CID 123432143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).