C13H15NO4 — CID 58235472
(2S)-2-(4-oxobutanoylamino)-3-phenylpropanoic acid (PubChem CID 58235472) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (2S)-2-(4-oxobutanoylamino)-3-phenylpropanoic acid.
| Compound Name | (2S)-2-(4-oxobutanoylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 58235472 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2S)-2-(4-oxobutanoylamino)-3-phenylpropanoic acid |
| SMILES | O=CCCC(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H15NO4/c15-8-4-7-12(16)14-11(13(17)18)9-10-5-2-1-3-6-10/h1-3,5-6,8,11H,4,7,9H2,(H,14,16)(H,17,18)/t11-/m0/s1 |
| InChIKey | WTOLWJCOKYFWND-NSHDSACASA-N |
| XLogP | 0.78 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|