About methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate
methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate (PubChem CID 69345761) has the molecular formula C9H9NO4
and a molecular weight of 195.17 g/mol. Its IUPAC name is methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate.
Molecular Properties
| Compound Name | methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate |
| PubChem CID | 69345761 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate |
| SMILES | COC(=O)C1NCC(=O)c2ccoc21 |
| InChI | InChI=1S/C9H9NO4/c1-13-9(12)7-8-5(2-3-14-8)6(11)4-10-7/h2-3,7,10H,4H2,1H3 |
| InChIKey | KFZUTPBYEOLWLA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate?
The IUPAC name of methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate (CID 69345761) is methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate.
What is the SMILES notation for methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate?
The canonical SMILES for methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate is COC(=O)C1NCC(=O)c2ccoc21.
What is the InChIKey of methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate?
The InChIKey is KFZUTPBYEOLWLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4/c1-13-9(12)7-8-5(2-3-14-8)6(11)4-10-7/h2-3,7,10H,4H2,1H3.
What are the key properties of methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate?
methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate has a molecular weight of 195.17 g/mol, XLogP of 0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxo-6,7-dihydro-5H-furo[2,3-c]pyridine-7-carboxylate is sourced from PubChem (CID 69345761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).