About methyl 4-amino-4,5,6,7-tetrahydro-1-benzofuran-6-carboxylate
methyl 4-amino-4,5,6,7-tetrahydro-1-benzofuran-6-carboxylate (PubChem CID 83915744) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is methyl 4-amino-4,5,6,7-tetrahydro-1-benzofuran-6-carboxylate.
Analyze methyl 4-amino-4,5,6,7-tetrahydro-1-benzofuran-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-4,5,6,7-tetrahydro-1-benzofuran-6-carboxylate?
The IUPAC name of methyl 4-amino-4,5,6,7-tetrahydro-1-benzofuran-6-carboxylate (CID 83915744) is methyl 4-amino-4,5,6,7-tetrahydro-1-benzofuran-6-carboxylate.
What is the SMILES notation for methyl 4-amino-4,5,6,7-tetrahydro-1-benzofuran-6-carboxylate?
The canonical SMILES for methyl 4-amino-4,5,6,7-tetrahydro-1-benzofuran-6-carboxylate is COC(=O)C1Cc2occc2C(N)C1.
What is the InChIKey of methyl 4-amino-4,5,6,7-tetrahydro-1-benzofuran-6-carboxylate?
The InChIKey is SOVUMBJMAWKPPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-13-10(12)6-4-8(11)7-2-3-14-9(7)5-6/h2-3,6,8H,4-5,11H2,1H3.
What are the key properties of methyl 4-amino-4,5,6,7-tetrahydro-1-benzofuran-6-carboxylate?
methyl 4-amino-4,5,6,7-tetrahydro-1-benzofuran-6-carboxylate has a molecular weight of 195.22 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-4,5,6,7-tetrahydro-1-benzofuran-6-carboxylate is sourced from PubChem (CID 83915744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).