About methyl 5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate
methyl 5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate (PubChem CID 102368825) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is methyl 5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate.
Analyze methyl 5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate?
The IUPAC name of methyl 5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate (CID 102368825) is methyl 5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate.
What is the SMILES notation for methyl 5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate?
The canonical SMILES for methyl 5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate is COC(=O)C1CC2=CC(=O)CC2C1.
What is the InChIKey of methyl 5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate?
The InChIKey is CSGMPZGOSJDYIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-13-10(12)8-2-6-4-9(11)5-7(6)3-8/h4,7-8H,2-3,5H2,1H3.
What are the key properties of methyl 5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate?
methyl 5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate has a molecular weight of 180.20 g/mol, XLogP of 1.08, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate is sourced from PubChem (CID 102368825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).