C10H15NO5 — CID 141157786
methyl 4-acetamido-3,5-dihydroxycyclohex-3-ene-1-carboxylate (PubChem CID 141157786) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is methyl 4-acetamido-3,5-dihydroxycyclohex-3-ene-1-carboxylate.
| Compound Name | methyl 4-acetamido-3,5-dihydroxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 141157786 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | methyl 4-acetamido-3,5-dihydroxycyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1CC(O)=C(NC(C)=O)C(O)C1 |
| InChI | InChI=1S/C10H15NO5/c1-5(12)11-9-7(13)3-6(4-8(9)14)10(15)16-2/h6-7,13-14H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | SQEWKXYJUXUWEW-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |