About trans-methyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate
trans-methyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate (PubChem CID 129411840) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is trans-methyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate.
Analyze trans-methyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate?
The IUPAC name of trans-methyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate (CID 129411840) is trans-methyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate.
What is the SMILES notation for trans-methyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate?
The canonical SMILES for trans-methyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate is COC(=O)[C@@H]1CC(=O)C[C@@H](C)C1.
What is the InChIKey of trans-methyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate?
The InChIKey is DKSHMDROPDHNSZ-BQBZGAKWSA-N. The full InChI is InChI=1S/C9H14O3/c1-6-3-7(9(11)12-2)5-8(10)4-6/h6-7H,3-5H2,1-2H3/t6-,7-/m0/s1.
What are the key properties of trans-methyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate?
trans-methyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate has a molecular weight of 170.21 g/mol, XLogP of 1.16, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1S,3S)-3-methyl-5-oxocyclohexane-1-carboxylate is sourced from PubChem (CID 129411840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).