C10H15NO3 — CID 98469608
methyl (1R,5R)-8-hydroxyiminobicyclo[3.2.1]octane-3-carboxylate (PubChem CID 98469608) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is methyl (1R,5R)-8-hydroxyiminobicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | methyl (1R,5R)-8-hydroxyiminobicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 98469608 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | methyl (1R,5R)-8-hydroxyiminobicyclo[3.2.1]octane-3-carboxylate |
| SMILES | COC(=O)C1C[C@H]2CC[C@H](C1)C2=NO |
| InChI | InChI=1S/C10H15NO3/c1-14-10(12)8-4-6-2-3-7(5-8)9(6)11-13/h6-8,13H,2-5H2,1H3/b11-9-/t6-,7-,8?/m1/s1 |
| InChIKey | POUPRTLZTAPIQQ-QUBGMVHJSA-N |
| XLogP | 1.43 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|