About dimethyl (1S,4S)-bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate
dimethyl (1S,4S)-bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate (PubChem CID 124541983) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is dimethyl (1S,4S)-bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate.
Analyze dimethyl (1S,4S)-bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (1S,4S)-bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate?
The IUPAC name of dimethyl (1S,4S)-bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate (CID 124541983) is dimethyl (1S,4S)-bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate.
What is the SMILES notation for dimethyl (1S,4S)-bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate?
The canonical SMILES for dimethyl (1S,4S)-bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate is COC(=O)C1=C(C(=O)OC)[C@H]2CC[C@H]1C2.
What is the InChIKey of dimethyl (1S,4S)-bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate?
The InChIKey is TUYAPTALYLXCPD-BQBZGAKWSA-N. The full InChI is InChI=1S/C11H14O4/c1-14-10(12)8-6-3-4-7(5-6)9(8)11(13)15-2/h6-7H,3-5H2,1-2H3/t6-,7-/m0/s1.
What are the key properties of dimethyl (1S,4S)-bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate?
dimethyl (1S,4S)-bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate has a molecular weight of 210.23 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (1S,4S)-bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate is sourced from PubChem (CID 124541983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).