C19H22O8 — CID 134941321
tetramethyl (2S,7R)-tricyclo[6.2.1.02,7]undeca-3,5-diene-3,4,5,6-tetracarboxylate (PubChem CID 134941321) has the molecular formula C19H22O8 and a molecular weight of 378.38 g/mol. Its IUPAC name is tetramethyl (2S,7R)-tricyclo[6.2.1.02,7]undeca-3,5-diene-3,4,5,6-tetracarboxylate.
| Compound Name | tetramethyl (2S,7R)-tricyclo[6.2.1.02,7]undeca-3,5-diene-3,4,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 134941321 |
| Molecular Formula | C19H22O8 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | tetramethyl (2S,7R)-tricyclo[6.2.1.02,7]undeca-3,5-diene-3,4,5,6-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2C3CCC(C3)[C@@H]2C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C19H22O8/c1-24-16(20)12-10-8-5-6-9(7-8)11(10)13(17(21)25-2)15(19(23)27-4)14(12)18(22)26-3/h8-11H,5-7H2,1-4H3/t8?,9?,10-,11+ |
| InChIKey | SSFXKFLWIZKXTC-HWACXVBKSA-N |
| XLogP | 0.95 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|