tricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid

C11H12O4 — CID 121221009

IUPACtricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid
SMILESO=C(O)C1=C(C(=O)O)C2C3CCC(C3)C12
InChIInChI=1S/C11H12O4/c12-10(13)8-6-4-1-2-5(3-4)7(6)9(8)11(14)15/h4-7H,1-3H2,(H,12,13)(H,14,15)
InChIKeyNDQOHCKBBFTDJG-UHFFFAOYSA-N
MW208.21 g/mol
LogP1.13
Rot. Bonds2

About tricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid

tricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid (PubChem CID 121221009) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is tricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid.

Molecular Properties

Compound Nametricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid
PubChem CID121221009
Molecular FormulaC11H12O4
Molecular Weight208.21 g/mol
Exact Mass208.07
IUPAC Nametricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid
SMILESO=C(O)C1=C(C(=O)O)C2C3CCC(C3)C12
InChIInChI=1S/C11H12O4/c12-10(13)8-6-4-1-2-5(3-4)7(6)9(8)11(14)15/h4-7H,1-3H2,(H,12,13)(H,14,15)
InChIKeyNDQOHCKBBFTDJG-UHFFFAOYSA-N
XLogP1.13
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.21
LogP ≤ 51.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze tricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid?
The IUPAC name of tricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid (CID 121221009) is tricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid.
What is the SMILES notation for tricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid?
The canonical SMILES for tricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid is O=C(O)C1=C(C(=O)O)C2C3CCC(C3)C12.
What is the InChIKey of tricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid?
The InChIKey is NDQOHCKBBFTDJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c12-10(13)8-6-4-1-2-5(3-4)7(6)9(8)11(14)15/h4-7H,1-3H2,(H,12,13)(H,14,15).
What are the key properties of tricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid?
tricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid has a molecular weight of 208.21 g/mol, XLogP of 1.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[4.2.1.02,5]non-3-ene-3,4-dicarboxylic acid is sourced from PubChem (CID 121221009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).