C16H17NO2 — CID 102467612
methyl 4-[(1S,2R,3S,4R)-3-cyano-2-bicyclo[2.2.1]heptanyl]benzoate (PubChem CID 102467612) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is methyl 4-[(1S,2R,3S,4R)-3-cyano-2-bicyclo[2.2.1]heptanyl]benzoate.
| Compound Name | methyl 4-[(1S,2R,3S,4R)-3-cyano-2-bicyclo[2.2.1]heptanyl]benzoate |
|---|---|
| PubChem CID | 102467612 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | methyl 4-[(1S,2R,3S,4R)-3-cyano-2-bicyclo[2.2.1]heptanyl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C#N)cc1 |
| InChI | InChI=1S/C16H17NO2/c1-19-16(18)11-4-2-10(3-5-11)15-13-7-6-12(8-13)14(15)9-17/h2-5,12-15H,6-8H2,1H3/t12-,13+,14+,15-/m1/s1 |
| InChIKey | VQHOJSNXFCKMHT-CBBWQLFWSA-N |
| XLogP | 3.13 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |