C10H9NO3 — CID 97359010
methyl (1S)-3-oxo-1,2-dihydroisoindole-1-carboxylate (PubChem CID 97359010) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is methyl (1S)-3-oxo-1,2-dihydroisoindole-1-carboxylate.
| Compound Name | methyl (1S)-3-oxo-1,2-dihydroisoindole-1-carboxylate |
|---|---|
| PubChem CID | 97359010 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | methyl (1S)-3-oxo-1,2-dihydroisoindole-1-carboxylate |
| SMILES | COC(=O)[C@H]1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C10H9NO3/c1-14-10(13)8-6-4-2-3-5-7(6)9(12)11-8/h2-5,8H,1H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | FTFQEIGJZWIFPE-QMMMGPOBSA-N |
| XLogP | 0.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |