C14H17ClN2O4 — CID 22852461
methyl (3S)-6-amino-1,7-dioxo-3,4,5,6-tetrahydro-2H-2-benzazonine-3-carboxylate;hydrochloride (PubChem CID 22852461) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is methyl (3S)-6-amino-1,7-dioxo-3,4,5,6-tetrahydro-2H-2-benzazonine-3-carboxylate;hydrochloride.
| Compound Name | methyl (3S)-6-amino-1,7-dioxo-3,4,5,6-tetrahydro-2H-2-benzazonine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 22852461 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | methyl (3S)-6-amino-1,7-dioxo-3,4,5,6-tetrahydro-2H-2-benzazonine-3-carboxylate;hydrochloride |
| SMILES | COC(=O)[C@@H]1CCC(N)C(=O)c2ccccc2C(=O)N1.Cl |
| InChI | InChI=1S/C14H16N2O4.ClH/c1-20-14(19)11-7-6-10(15)12(17)8-4-2-3-5-9(8)13(18)16-11;/h2-5,10-11H,6-7,15H2,1H3,(H,16,18);1H/t10?,11-;/m0./s1 |
| InChIKey | WQROBGHLHPZOKB-GQNCZFCYSA-N |
| XLogP | 0.68 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |