methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate

C10H8BrNO3 — CID 53375261

IUPACmethyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate
SMILESCOC(=O)C1NC(=O)c2cc(Br)ccc21
InChIInChI=1S/C10H8BrNO3/c1-15-10(14)8-6-3-2-5(11)4-7(6)9(13)12-8/h2-4,8H,1H3,(H,12,13)
InChIKeyAQSXOQHMTAFORM-UHFFFAOYSA-N
MW270.08 g/mol
LogP1.41
Rot. Bonds1

About methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate

methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate (PubChem CID 53375261) has the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. Its IUPAC name is methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate.

Molecular Properties

Compound Namemethyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate
PubChem CID53375261
Molecular FormulaC10H8BrNO3
Molecular Weight270.08 g/mol
Exact Mass268.97
IUPAC Namemethyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate
SMILESCOC(=O)C1NC(=O)c2cc(Br)ccc21
InChIInChI=1S/C10H8BrNO3/c1-15-10(14)8-6-3-2-5(11)4-7(6)9(13)12-8/h2-4,8H,1H3,(H,12,13)
InChIKeyAQSXOQHMTAFORM-UHFFFAOYSA-N
XLogP1.41
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.08
LogP ≤ 51.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate?
The IUPAC name of methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate (CID 53375261) is methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate.
What is the SMILES notation for methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate?
The canonical SMILES for methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate is COC(=O)C1NC(=O)c2cc(Br)ccc21.
What is the InChIKey of methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate?
The InChIKey is AQSXOQHMTAFORM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrNO3/c1-15-10(14)8-6-3-2-5(11)4-7(6)9(13)12-8/h2-4,8H,1H3,(H,12,13).
What are the key properties of methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate?
methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate has a molecular weight of 270.08 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate is sourced from PubChem (CID 53375261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).