C10H8BrNO3 — CID 53375261
methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate (PubChem CID 53375261) has the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. Its IUPAC name is methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate.
| Compound Name | methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate |
|---|---|
| PubChem CID | 53375261 |
| Molecular Formula | C10H8BrNO3 |
| Molecular Weight | 270.08 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | methyl 5-bromo-3-oxo-1,2-dihydroisoindole-1-carboxylate |
| SMILES | COC(=O)C1NC(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C10H8BrNO3/c1-15-10(14)8-6-3-2-5(11)4-7(6)9(13)12-8/h2-4,8H,1H3,(H,12,13) |
| InChIKey | AQSXOQHMTAFORM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.08 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |