C15H18BrN3O5 — CID 163259640
methyl 6-bromo-7-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-3-oxo-1,2-dihydroisoindole-1-carboxylate (PubChem CID 163259640) has the molecular formula C15H18BrN3O5 and a molecular weight of 400.23 g/mol. Its IUPAC name is methyl 6-bromo-7-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-3-oxo-1,2-dihydroisoindole-1-carboxylate.
| Compound Name | methyl 6-bromo-7-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-3-oxo-1,2-dihydroisoindole-1-carboxylate |
|---|---|
| PubChem CID | 163259640 |
| Molecular Formula | C15H18BrN3O5 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | methyl 6-bromo-7-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-3-oxo-1,2-dihydroisoindole-1-carboxylate |
| SMILES | COC(=O)C1NC(=O)c2ccc(Br)c(NNC(=O)OC(C)(C)C)c21 |
| InChI | InChI=1S/C15H18BrN3O5/c1-15(2,3)24-14(22)19-18-10-8(16)6-5-7-9(10)11(13(21)23-4)17-12(7)20/h5-6,11,18H,1-4H3,(H,17,20)(H,19,22) |
| InChIKey | VICQCCZVBOBJTA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|